C14H24F6N2O — CID 2836449
3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,1-dipentylurea (PubChem CID 2836449) has the molecular formula C14H24F6N2O and a molecular weight of 350.35 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,1-dipentylurea.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,1-dipentylurea |
|---|---|
| PubChem CID | 2836449 |
| Molecular Formula | C14H24F6N2O |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,1-dipentylurea |
| SMILES | CCCCCN(CCCCC)C(=O)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H24F6N2O/c1-3-5-7-9-22(10-8-6-4-2)12(23)21-11(13(15,16)17)14(18,19)20/h11H,3-10H2,1-2H3,(H,21,23) |
| InChIKey | PPIWAXZJECLDBB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|