C19H22BrN3O4 — CID 2836469
6-bromo-1-cyclohexyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine;oxalic acid (PubChem CID 2836469) has the molecular formula C19H22BrN3O4 and a molecular weight of 436.31 g/mol. Its IUPAC name is 6-bromo-1-cyclohexyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine;oxalic acid.
| Compound Name | 6-bromo-1-cyclohexyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine;oxalic acid |
|---|---|
| PubChem CID | 2836469 |
| Molecular Formula | C19H22BrN3O4 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 6-bromo-1-cyclohexyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine;oxalic acid |
| SMILES | Nc1c2c(nc3ccc(Br)cc13)N(C1CCCCC1)CC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H20BrN3.C2H2O4/c18-11-6-7-15-14(10-11)16(19)13-8-9-21(17(13)20-15)12-4-2-1-3-5-12;3-1(4)2(5)6/h6-7,10,12H,1-5,8-9H2,(H2,19,20);(H,3,4)(H,5,6) |
| InChIKey | MCSSUBTVJCNDPE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|