About N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine
N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine (PubChem CID 2836626) has the molecular formula C13H10N4O3
and a molecular weight of 270.25 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine.
Molecular Properties
| Compound Name | N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
| PubChem CID | 2836626 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
| SMILES | Cc1ccc(Nc2ccc3nonc3c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H10N4O3/c1-8-2-4-9(5-3-8)14-11-7-6-10-12(16-20-15-10)13(11)17(18)19/h2-7,14H,1H3 |
| InChIKey | WVWIAWCTHQDIBO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine?
The IUPAC name of N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine (CID 2836626) is N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine.
What is the SMILES notation for N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine?
The canonical SMILES for N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine is Cc1ccc(Nc2ccc3nonc3c2[N+](=O)[O-])cc1.
What is the InChIKey of N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine?
The InChIKey is WVWIAWCTHQDIBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O3/c1-8-2-4-9(5-3-8)14-11-7-6-10-12(16-20-15-10)13(11)17(18)19/h2-7,14H,1H3.
What are the key properties of N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine?
N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine has a molecular weight of 270.25 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine is sourced from PubChem (CID 2836626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).