About 2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide
2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide (PubChem CID 2836704) has the molecular formula C18H24BrNOS2
and a molecular weight of 414.43 g/mol. Its IUPAC name is 2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide.
Molecular Properties
| Compound Name | 2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide |
| PubChem CID | 2836704 |
| Molecular Formula | C18H24BrNOS2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide |
| SMILES | Br.CCC1(C)CC(c2nc(-c3ccc(OC)cc3)cs2)CCS1 |
| InChI | InChI=1S/C18H23NOS2.BrH/c1-4-18(2)11-14(9-10-22-18)17-19-16(12-21-17)13-5-7-15(20-3)8-6-13;/h5-8,12,14H,4,9-11H2,1-3H3;1H |
| InChIKey | BHOGRKVNZFRSJG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide?
The IUPAC name of 2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide (CID 2836704) is 2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide.
What is the SMILES notation for 2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide?
The canonical SMILES for 2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide is Br.CCC1(C)CC(c2nc(-c3ccc(OC)cc3)cs2)CCS1.
What is the InChIKey of 2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide?
The InChIKey is BHOGRKVNZFRSJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NOS2.BrH/c1-4-18(2)11-14(9-10-22-18)17-19-16(12-21-17)13-5-7-15(20-3)8-6-13;/h5-8,12,14H,4,9-11H2,1-3H3;1H.
What are the key properties of 2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide?
2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide has a molecular weight of 414.43 g/mol, XLogP of 6.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethyl-2-methylthian-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole;hydrobromide is sourced from PubChem (CID 2836704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).