C26H21NO2 — CID 2836799
17-benzyl-1-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 2836799) has the molecular formula C26H21NO2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 17-benzyl-1-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 17-benzyl-1-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 2836799 |
| Molecular Formula | C26H21NO2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 17-benzyl-1-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CC12c3ccccc3C(c3ccccc31)C1C(=O)N(Cc3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C26H21NO2/c1-26-19-13-7-5-11-17(19)21(18-12-6-8-14-20(18)26)22-23(26)25(29)27(24(22)28)15-16-9-3-2-4-10-16/h2-14,21-23H,15H2,1H3 |
| InChIKey | HYZSIEBKDVUFGI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|