C24H31BrN2O2 — CID 2836828
1-N-(4-bromophenyl)-2-N,2-N-dipentylbenzene-1,2-dicarboxamide (PubChem CID 2836828) has the molecular formula C24H31BrN2O2 and a molecular weight of 459.43 g/mol. Its IUPAC name is 1-N-(4-bromophenyl)-2-N,2-N-dipentylbenzene-1,2-dicarboxamide.
| Compound Name | 1-N-(4-bromophenyl)-2-N,2-N-dipentylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 2836828 |
| Molecular Formula | C24H31BrN2O2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 1-N-(4-bromophenyl)-2-N,2-N-dipentylbenzene-1,2-dicarboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)c1ccccc1C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H31BrN2O2/c1-3-5-9-17-27(18-10-6-4-2)24(29)22-12-8-7-11-21(22)23(28)26-20-15-13-19(25)14-16-20/h7-8,11-16H,3-6,9-10,17-18H2,1-2H3,(H,26,28) |
| InChIKey | OITHNNNIGWHOAY-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|