About [2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate
[2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate (PubChem CID 2837059) has the molecular formula C15H12F3NO5S
and a molecular weight of 375.32 g/mol. Its IUPAC name is [2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate |
| PubChem CID | 2837059 |
| Molecular Formula | C15H12F3NO5S |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | [2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(c2ccccc2F)C(F)(F)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12F3NO5S/c1-10-6-8-11(9-7-10)25(22,23)24-14(15(17,18)19(20)21)12-4-2-3-5-13(12)16/h2-9,14H,1H3 |
| InChIKey | ALTZTRZPAFHGNQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate?
The IUPAC name of [2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate (CID 2837059) is [2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate?
The canonical SMILES for [2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC(c2ccccc2F)C(F)(F)[N+](=O)[O-])cc1.
What is the InChIKey of [2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate?
The InChIKey is ALTZTRZPAFHGNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F3NO5S/c1-10-6-8-11(9-7-10)25(22,23)24-14(15(17,18)19(20)21)12-4-2-3-5-13(12)16/h2-9,14H,1H3.
What are the key properties of [2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate?
[2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate has a molecular weight of 375.32 g/mol, XLogP of 3.45, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-1-(2-fluorophenyl)-2-nitroethyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 2837059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).