About ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate
ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate (PubChem CID 2837105) has the molecular formula C23H24O4
and a molecular weight of 364.44 g/mol. Its IUPAC name is ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate |
| PubChem CID | 2837105 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate |
| SMILES | CCCc1ccc(CC2(CC(=O)OCC)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H24O4/c1-3-7-16-10-12-17(13-11-16)14-23(15-20(24)27-4-2)21(25)18-8-5-6-9-19(18)22(23)26/h5-6,8-13H,3-4,7,14-15H2,1-2H3 |
| InChIKey | IISQSHKTDDOTQF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate?
The IUPAC name of ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate (CID 2837105) is ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate.
What is the SMILES notation for ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate?
The canonical SMILES for ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate is CCCc1ccc(CC2(CC(=O)OCC)C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate?
The InChIKey is IISQSHKTDDOTQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O4/c1-3-7-16-10-12-17(13-11-16)14-23(15-20(24)27-4-2)21(25)18-8-5-6-9-19(18)22(23)26/h5-6,8-13H,3-4,7,14-15H2,1-2H3.
What are the key properties of ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate?
ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate has a molecular weight of 364.44 g/mol, XLogP of 4.20, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1,3-dioxo-2-[(4-propylphenyl)methyl]inden-2-yl]acetate is sourced from PubChem (CID 2837105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).