About N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine
N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine (PubChem CID 2837279) has the molecular formula C12H10N4O5
and a molecular weight of 290.24 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine.
Molecular Properties
| Compound Name | N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine |
| PubChem CID | 2837279 |
| Molecular Formula | C12H10N4O5 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine |
| SMILES | COc1ccccc1Nc1ncc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10N4O5/c1-21-11-5-3-2-4-9(11)14-12-10(16(19)20)6-8(7-13-12)15(17)18/h2-7H,1H3,(H,13,14) |
| InChIKey | WOTSKDVAWCTHMA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine?
The IUPAC name of N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine (CID 2837279) is N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine.
What is the SMILES notation for N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine?
The canonical SMILES for N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine is COc1ccccc1Nc1ncc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine?
The InChIKey is WOTSKDVAWCTHMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O5/c1-21-11-5-3-2-4-9(11)14-12-10(16(19)20)6-8(7-13-12)15(17)18/h2-7H,1H3,(H,13,14).
What are the key properties of N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine?
N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine has a molecular weight of 290.24 g/mol, XLogP of 2.65, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyphenyl)-3,5-dinitropyridin-2-amine is sourced from PubChem (CID 2837279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).