About 6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride
6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride (PubChem CID 2837438) has the molecular formula C13H13ClN4S
and a molecular weight of 292.80 g/mol. Its IUPAC name is 6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride |
| PubChem CID | 2837438 |
| Molecular Formula | C13H13ClN4S |
| Molecular Weight | 292.80 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride |
| SMILES | CCc1cc2c(Nc3ccncc3)ncnc2s1.Cl |
| InChI | InChI=1S/C13H12N4S.ClH/c1-2-10-7-11-12(15-8-16-13(11)18-10)17-9-3-5-14-6-4-9;/h3-8H,2H2,1H3,(H,14,15,16,17);1H |
| InChIKey | SVBBYARWPLQIRL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.80 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride?
The IUPAC name of 6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride (CID 2837438) is 6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride.
What is the SMILES notation for 6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride?
The canonical SMILES for 6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride is CCc1cc2c(Nc3ccncc3)ncnc2s1.Cl.
What is the InChIKey of 6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride?
The InChIKey is SVBBYARWPLQIRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4S.ClH/c1-2-10-7-11-12(15-8-16-13(11)18-10)17-9-3-5-14-6-4-9;/h3-8H,2H2,1H3,(H,14,15,16,17);1H.
What are the key properties of 6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride?
6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride has a molecular weight of 292.80 g/mol, XLogP of 3.81, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-N-pyridin-4-ylthieno[2,3-d]pyrimidin-4-amine;hydrochloride is sourced from PubChem (CID 2837438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).