About 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline
8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline (PubChem CID 2837747) has the molecular formula C14H8N4O
and a molecular weight of 248.25 g/mol. Its IUPAC name is 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline.
Molecular Properties
| Compound Name | 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline |
| PubChem CID | 2837747 |
| Molecular Formula | C14H8N4O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline |
| SMILES | c1ccc(-c2cc3c(ccc4nonc43)nn2)cc1 |
| InChI | InChI=1S/C14H8N4O/c1-2-4-9(5-3-1)13-8-10-11(15-16-13)6-7-12-14(10)18-19-17-12/h1-8H |
| InChIKey | GJJKCCBTWZRCFD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline?
The IUPAC name of 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline (CID 2837747) is 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline.
What is the SMILES notation for 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline?
The canonical SMILES for 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline is c1ccc(-c2cc3c(ccc4nonc43)nn2)cc1.
What is the InChIKey of 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline?
The InChIKey is GJJKCCBTWZRCFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N4O/c1-2-4-9(5-3-1)13-8-10-11(15-16-13)6-7-12-14(10)18-19-17-12/h1-8H.
What are the key properties of 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline?
8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline has a molecular weight of 248.25 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline is sourced from PubChem (CID 2837747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).