About ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate
ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate (PubChem CID 2838426) has the molecular formula C17H25NO5
and a molecular weight of 323.39 g/mol. Its IUPAC name is ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate |
| PubChem CID | 2838426 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(Cc2cc(OC)c(O)c(OC)c2)C1 |
| InChI | InChI=1S/C17H25NO5/c1-4-23-17(20)13-6-5-7-18(11-13)10-12-8-14(21-2)16(19)15(9-12)22-3/h8-9,13,19H,4-7,10-11H2,1-3H3 |
| InChIKey | UYHHBIMZDYSKCQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate?
The IUPAC name of ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate (CID 2838426) is ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate.
What is the SMILES notation for ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate?
The canonical SMILES for ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate is CCOC(=O)C1CCCN(Cc2cc(OC)c(O)c(OC)c2)C1.
What is the InChIKey of ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate?
The InChIKey is UYHHBIMZDYSKCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO5/c1-4-23-17(20)13-6-5-7-18(11-13)10-12-8-14(21-2)16(19)15(9-12)22-3/h8-9,13,19H,4-7,10-11H2,1-3H3.
What are the key properties of ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate?
ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate has a molecular weight of 323.39 g/mol, XLogP of 2.18, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]piperidine-3-carboxylate is sourced from PubChem (CID 2838426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).