C13H10N4O6 — CID 2838912
3,5-dinitro-2-(pyridin-3-ylmethylamino)benzoic acid (PubChem CID 2838912) has the molecular formula C13H10N4O6 and a molecular weight of 318.25 g/mol. Its IUPAC name is 3,5-dinitro-2-(pyridin-3-ylmethylamino)benzoic acid.
| Compound Name | 3,5-dinitro-2-(pyridin-3-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 2838912 |
| Molecular Formula | C13H10N4O6 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3,5-dinitro-2-(pyridin-3-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1NCc1cccnc1 |
| InChI | InChI=1S/C13H10N4O6/c18-13(19)10-4-9(16(20)21)5-11(17(22)23)12(10)15-7-8-2-1-3-14-6-8/h1-6,15H,7H2,(H,18,19) |
| InChIKey | IFIAYXKKGYKTGN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 148.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|