About 2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide
2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide (PubChem CID 2839048) has the molecular formula C21H12ClNO3
and a molecular weight of 361.78 g/mol. Its IUPAC name is 2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide.
Molecular Properties
| Compound Name | 2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide |
| PubChem CID | 2839048 |
| Molecular Formula | C21H12ClNO3 |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide |
| SMILES | O=C(Nc1cccc2c1C(=O)c1ccccc1C2=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H12ClNO3/c22-16-10-4-3-8-14(16)21(26)23-17-11-5-9-15-18(17)20(25)13-7-2-1-6-12(13)19(15)24/h1-11H,(H,23,26) |
| InChIKey | OXTNQKFXUFNLGY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide?
The IUPAC name of 2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide (CID 2839048) is 2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide.
What is the SMILES notation for 2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide?
The canonical SMILES for 2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide is O=C(Nc1cccc2c1C(=O)c1ccccc1C2=O)c1ccccc1Cl.
What is the InChIKey of 2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide?
The InChIKey is OXTNQKFXUFNLGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12ClNO3/c22-16-10-4-3-8-14(16)21(26)23-17-11-5-9-15-18(17)20(25)13-7-2-1-6-12(13)19(15)24/h1-11H,(H,23,26).
What are the key properties of 2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide?
2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide has a molecular weight of 361.78 g/mol, XLogP of 4.37, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(9,10-dioxoanthracen-1-yl)benzamide is sourced from PubChem (CID 2839048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).