C19H14Cl2N4 — CID 2839218
2-amino-4-(3,4-dichlorophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 2839218) has the molecular formula C19H14Cl2N4 and a molecular weight of 369.26 g/mol. Its IUPAC name is 2-amino-4-(3,4-dichlorophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | 2-amino-4-(3,4-dichlorophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 2839218 |
| Molecular Formula | C19H14Cl2N4 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 2-amino-4-(3,4-dichlorophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)C(c2ccc(Cl)c(Cl)c2)C2CCCC=C12 |
| InChI | InChI=1S/C19H14Cl2N4/c20-15-6-5-11(7-16(15)21)17-13-4-2-1-3-12(13)14(8-22)18(25)19(17,9-23)10-24/h3,5-7,13,17H,1-2,4,25H2 |
| InChIKey | RPJCHGSFHZNJLG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|