C20H15N3O — CID 2839244
2,7-diamino-4-naphthalen-2-yl-4H-chromene-3-carbonitrile (PubChem CID 2839244) has the molecular formula C20H15N3O and a molecular weight of 313.36 g/mol. Its IUPAC name is 2,7-diamino-4-naphthalen-2-yl-4H-chromene-3-carbonitrile.
| Compound Name | 2,7-diamino-4-naphthalen-2-yl-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 2839244 |
| Molecular Formula | C20H15N3O |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2,7-diamino-4-naphthalen-2-yl-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(N)ccc2C1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H15N3O/c21-11-17-19(14-6-5-12-3-1-2-4-13(12)9-14)16-8-7-15(22)10-18(16)24-20(17)23/h1-10,19H,22-23H2 |
| InChIKey | JZJOSVNTFVUQIV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|