2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid

C14H15Cl2NO3 — CID 2839323

IUPAC2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid
SMILESO=C(O)C1CCCCC1C(=O)Nc1cc(Cl)ccc1Cl
InChIInChI=1S/C14H15Cl2NO3/c15-8-5-6-11(16)12(7-8)17-13(18)9-3-1-2-4-10(9)14(19)20/h5-7,9-10H,1-4H2,(H,17,18)(H,19,20)
InChIKeySUEJGYILKDAFBF-UHFFFAOYSA-N
MW316.18 g/mol
LogP3.82
Rot. Bonds3

About 2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid

2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 2839323) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid
PubChem CID2839323
Molecular FormulaC14H15Cl2NO3
Molecular Weight316.18 g/mol
Exact Mass315.04
IUPAC Name2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid
SMILESO=C(O)C1CCCCC1C(=O)Nc1cc(Cl)ccc1Cl
InChIInChI=1S/C14H15Cl2NO3/c15-8-5-6-11(16)12(7-8)17-13(18)9-3-1-2-4-10(9)14(19)20/h5-7,9-10H,1-4H2,(H,17,18)(H,19,20)
InChIKeySUEJGYILKDAFBF-UHFFFAOYSA-N
XLogP3.82
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.18
LogP ≤ 53.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid?
The IUPAC name of 2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid (CID 2839323) is 2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for 2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid is O=C(O)C1CCCCC1C(=O)Nc1cc(Cl)ccc1Cl.
What is the InChIKey of 2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid?
The InChIKey is SUEJGYILKDAFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2NO3/c15-8-5-6-11(16)12(7-8)17-13(18)9-3-1-2-4-10(9)14(19)20/h5-7,9-10H,1-4H2,(H,17,18)(H,19,20).
What are the key properties of 2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid?
2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid has a molecular weight of 316.18 g/mol, XLogP of 3.82, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 2839323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).