C19H19F3N2O3 — CID 2839419
ethyl 6-amino-5-cyano-2-propyl-4-[3-(trifluoromethyl)phenyl]-4H-pyran-3-carboxylate (PubChem CID 2839419) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-2-propyl-4-[3-(trifluoromethyl)phenyl]-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-2-propyl-4-[3-(trifluoromethyl)phenyl]-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 2839419 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | ethyl 6-amino-5-cyano-2-propyl-4-[3-(trifluoromethyl)phenyl]-4H-pyran-3-carboxylate |
| SMILES | CCCC1=C(C(=O)OCC)C(c2cccc(C(F)(F)F)c2)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C19H19F3N2O3/c1-3-6-14-16(18(25)26-4-2)15(13(10-23)17(24)27-14)11-7-5-8-12(9-11)19(20,21)22/h5,7-9,15H,3-4,6,24H2,1-2H3 |
| InChIKey | RSTCAGIMLACKSO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |