About 2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione
2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione (PubChem CID 2839655) has the molecular formula C24H19NO4
and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione.
Molecular Properties
| Compound Name | 2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione |
| PubChem CID | 2839655 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione |
| SMILES | Cc1ccc(C(c2ccccc2)C2([N+](=O)[O-])C(=O)c3ccccc3C2=O)c(C)c1 |
| InChI | InChI=1S/C24H19NO4/c1-15-12-13-18(16(2)14-15)21(17-8-4-3-5-9-17)24(25(28)29)22(26)19-10-6-7-11-20(19)23(24)27/h3-14,21H,1-2H3 |
| InChIKey | LIQFTDFFTGZGCH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione?
The IUPAC name of 2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione (CID 2839655) is 2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione.
What is the SMILES notation for 2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione?
The canonical SMILES for 2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione is Cc1ccc(C(c2ccccc2)C2([N+](=O)[O-])C(=O)c3ccccc3C2=O)c(C)c1.
What is the InChIKey of 2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione?
The InChIKey is LIQFTDFFTGZGCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19NO4/c1-15-12-13-18(16(2)14-15)21(17-8-4-3-5-9-17)24(25(28)29)22(26)19-10-6-7-11-20(19)23(24)27/h3-14,21H,1-2H3.
What are the key properties of 2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione?
2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione has a molecular weight of 385.42 g/mol, XLogP of 4.53, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dimethylphenyl)-phenylmethyl]-2-nitroindene-1,3-dione is sourced from PubChem (CID 2839655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).