C18H24N4O3 — CID 2839905
1-benzyl-5-[2-(diethylamino)ethyliminomethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 2839905) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-benzyl-5-[2-(diethylamino)ethyliminomethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-benzyl-5-[2-(diethylamino)ethyliminomethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2839905 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-benzyl-5-[2-(diethylamino)ethyliminomethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCN(CC)CC/N=C/c1c(O)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H24N4O3/c1-3-21(4-2)11-10-19-12-15-16(23)20-18(25)22(17(15)24)13-14-8-6-5-7-9-14/h5-9,12,24H,3-4,10-11,13H2,1-2H3,(H,20,23,25)/b19-12+ |
| InChIKey | FVMSPBCIZLTLEU-XDHOZWIPSA-N |
| XLogP | 1.05 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|