C26H34N2 — CID 2840003
1,2,2,4-tetramethyl-6-(1,2,2,4-tetramethyl-3H-quinolin-4-yl)quinoline (PubChem CID 2840003) has the molecular formula C26H34N2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 1,2,2,4-tetramethyl-6-(1,2,2,4-tetramethyl-3H-quinolin-4-yl)quinoline.
| Compound Name | 1,2,2,4-tetramethyl-6-(1,2,2,4-tetramethyl-3H-quinolin-4-yl)quinoline |
|---|---|
| PubChem CID | 2840003 |
| Molecular Formula | C26H34N2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 1,2,2,4-tetramethyl-6-(1,2,2,4-tetramethyl-3H-quinolin-4-yl)quinoline |
| SMILES | CC1=CC(C)(C)N(C)c2ccc(C3(C)CC(C)(C)N(C)c4ccccc43)cc21 |
| InChI | InChI=1S/C26H34N2/c1-18-16-24(2,3)27(7)22-14-13-19(15-20(18)22)26(6)17-25(4,5)28(8)23-12-10-9-11-21(23)26/h9-16H,17H2,1-8H3 |
| InChIKey | NJKVMHDSHINWMM-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |