C20H23NO4S — CID 2840042
3-benzyl-5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 2840042) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 3-benzyl-5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-benzyl-5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2840042 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 3-benzyl-5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1cc(C2SC(C)C(=O)N2Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H23NO4S/c1-13-19(22)21(12-14-8-6-5-7-9-14)20(26-13)15-10-16(23-2)18(25-4)17(11-15)24-3/h5-11,13,20H,12H2,1-4H3 |
| InChIKey | AAJJHHGUJSAWSK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |