C16H18N2O3 — CID 2840515
ethyl 8-formamido-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 2840515) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is ethyl 8-formamido-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | ethyl 8-formamido-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 2840515 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | ethyl 8-formamido-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccc2[nH]c3c(c2c1)CCCC3NC=O |
| InChI | InChI=1S/C16H18N2O3/c1-2-21-16(20)10-6-7-13-12(8-10)11-4-3-5-14(17-9-19)15(11)18-13/h6-9,14,18H,2-5H2,1H3,(H,17,19) |
| InChIKey | MXEQDRYQXJDDCX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|