C15H17N3OS — CID 2841037
3-amino-4,7,7-trimethyl-5-oxo-4,6,8,9-tetrahydrothieno[2,3-b]quinoline-2-carbonitrile (PubChem CID 2841037) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 3-amino-4,7,7-trimethyl-5-oxo-4,6,8,9-tetrahydrothieno[2,3-b]quinoline-2-carbonitrile.
| Compound Name | 3-amino-4,7,7-trimethyl-5-oxo-4,6,8,9-tetrahydrothieno[2,3-b]quinoline-2-carbonitrile |
|---|---|
| PubChem CID | 2841037 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-amino-4,7,7-trimethyl-5-oxo-4,6,8,9-tetrahydrothieno[2,3-b]quinoline-2-carbonitrile |
| SMILES | CC1C2=C(CC(C)(C)CC2=O)Nc2sc(C#N)c(N)c21 |
| InChI | InChI=1S/C15H17N3OS/c1-7-11-8(4-15(2,3)5-9(11)19)18-14-12(7)13(17)10(6-16)20-14/h7,18H,4-5,17H2,1-3H3 |
| InChIKey | OHNXUGCTTBMXLU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |