C12H13N3OS — CID 2841074
4,4-dimethyl-2-oxo-6-prop-2-enylsulfanyl-1,3-dihydropyridine-3,5-dicarbonitrile (PubChem CID 2841074) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 4,4-dimethyl-2-oxo-6-prop-2-enylsulfanyl-1,3-dihydropyridine-3,5-dicarbonitrile.
| Compound Name | 4,4-dimethyl-2-oxo-6-prop-2-enylsulfanyl-1,3-dihydropyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 2841074 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4,4-dimethyl-2-oxo-6-prop-2-enylsulfanyl-1,3-dihydropyridine-3,5-dicarbonitrile |
| SMILES | C=CCSC1=C(C#N)C(C)(C)C(C#N)C(=O)N1 |
| InChI | InChI=1S/C12H13N3OS/c1-4-5-17-11-9(7-14)12(2,3)8(6-13)10(16)15-11/h4,8H,1,5H2,2-3H3,(H,15,16) |
| InChIKey | MTCAWEXPGWORMN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|