C10H11N3OS — CID 2841170
1-(5-amino-2-phenyl-2H-1,3,4-thiadiazol-3-yl)ethanone (PubChem CID 2841170) has the molecular formula C10H11N3OS and a molecular weight of 221.29 g/mol. Its IUPAC name is 1-(5-amino-2-phenyl-2H-1,3,4-thiadiazol-3-yl)ethanone.
| Compound Name | 1-(5-amino-2-phenyl-2H-1,3,4-thiadiazol-3-yl)ethanone |
|---|---|
| PubChem CID | 2841170 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1-(5-amino-2-phenyl-2H-1,3,4-thiadiazol-3-yl)ethanone |
| SMILES | CC(=O)N1N=C(N)SC1c1ccccc1 |
| InChI | InChI=1S/C10H11N3OS/c1-7(14)13-9(15-10(11)12-13)8-5-3-2-4-6-8/h2-6,9H,1H3,(H2,11,12) |
| InChIKey | FSUOZVHASSEDMX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |