About 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride
2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride (PubChem CID 2841226) has the molecular formula C14H20ClNO3
and a molecular weight of 285.77 g/mol. Its IUPAC name is 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride.
Molecular Properties
| Compound Name | 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride |
| PubChem CID | 2841226 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride |
| SMILES | Cl.O=C(CNC1CCCCC1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H19NO3.ClH/c16-12-7-6-10(8-13(12)17)14(18)9-15-11-4-2-1-3-5-11;/h6-8,11,15-17H,1-5,9H2;1H |
| InChIKey | IRACFPUZETUEIN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride?
The IUPAC name of 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride (CID 2841226) is 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride.
What is the SMILES notation for 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride?
The canonical SMILES for 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride is Cl.O=C(CNC1CCCCC1)c1ccc(O)c(O)c1.
What is the InChIKey of 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride?
The InChIKey is IRACFPUZETUEIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3.ClH/c16-12-7-6-10(8-13(12)17)14(18)9-15-11-4-2-1-3-5-11;/h6-8,11,15-17H,1-5,9H2;1H.
What are the key properties of 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride?
2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride has a molecular weight of 285.77 g/mol, XLogP of 2.62, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone;hydrochloride is sourced from PubChem (CID 2841226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).