About 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide
2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide (PubChem CID 2841502) has the molecular formula C15H14Br2N2
and a molecular weight of 382.10 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide |
| PubChem CID | 2841502 |
| Molecular Formula | C15H14Br2N2 |
| Molecular Weight | 382.10 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide |
| SMILES | Br.[H]/N=C1\Cc2ccccc2CN1c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H13BrN2.BrH/c16-13-5-7-14(8-6-13)18-10-12-4-2-1-3-11(12)9-15(18)17;/h1-8,17H,9-10H2;1H/b17-15+; |
| InChIKey | FQDNXIIEIGKRBI-INTLEYBYSA-N |
| XLogP | 4.57 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.10 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide?
The IUPAC name of 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide (CID 2841502) is 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide.
What is the SMILES notation for 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide?
The canonical SMILES for 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide is Br.[H]/N=C1\Cc2ccccc2CN1c1ccc(Br)cc1.
What is the InChIKey of 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide?
The InChIKey is FQDNXIIEIGKRBI-INTLEYBYSA-N. The full InChI is InChI=1S/C15H13BrN2.BrH/c16-13-5-7-14(8-6-13)18-10-12-4-2-1-3-11(12)9-15(18)17;/h1-8,17H,9-10H2;1H/b17-15+;.
What are the key properties of 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide?
2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide has a molecular weight of 382.10 g/mol, XLogP of 4.57, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine;hydrobromide is sourced from PubChem (CID 2841502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).