About 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine
2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine (PubChem CID 2841503) has the molecular formula C15H13BrN2
and a molecular weight of 301.19 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine |
| PubChem CID | 2841503 |
| Molecular Formula | C15H13BrN2 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine |
| SMILES | [H]/N=C1\Cc2ccccc2CN1c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H13BrN2/c16-13-5-7-14(8-6-13)18-10-12-4-2-1-3-11(12)9-15(18)17/h1-8,17H,9-10H2/b17-15+ |
| InChIKey | QULHKHARXHLGMF-BMRADRMJSA-N |
| XLogP | 3.99 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine?
The IUPAC name of 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine (CID 2841503) is 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine.
What is the SMILES notation for 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine?
The canonical SMILES for 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine is [H]/N=C1\Cc2ccccc2CN1c1ccc(Br)cc1.
What is the InChIKey of 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine?
The InChIKey is QULHKHARXHLGMF-BMRADRMJSA-N. The full InChI is InChI=1S/C15H13BrN2/c16-13-5-7-14(8-6-13)18-10-12-4-2-1-3-11(12)9-15(18)17/h1-8,17H,9-10H2/b17-15+.
What are the key properties of 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine?
2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine has a molecular weight of 301.19 g/mol, XLogP of 3.99, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-1,4-dihydroisoquinolin-3-imine is sourced from PubChem (CID 2841503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).