About 2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one
2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one (PubChem CID 2841517) has the molecular formula C11H12N2OS
and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one.
Molecular Properties
| Compound Name | 2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one |
| PubChem CID | 2841517 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one |
| SMILES | Cc1ccccc1CC1SC(N)=NC1=O |
| InChI | InChI=1S/C11H12N2OS/c1-7-4-2-3-5-8(7)6-9-10(14)13-11(12)15-9/h2-5,9H,6H2,1H3,(H2,12,13,14) |
| InChIKey | MVYNQLNXBSDENN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one?
The IUPAC name of 2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one (CID 2841517) is 2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one.
What is the SMILES notation for 2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one?
The canonical SMILES for 2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one is Cc1ccccc1CC1SC(N)=NC1=O.
What is the InChIKey of 2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one?
The InChIKey is MVYNQLNXBSDENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2OS/c1-7-4-2-3-5-8(7)6-9-10(14)13-11(12)15-9/h2-5,9H,6H2,1H3,(H2,12,13,14).
What are the key properties of 2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one?
2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one has a molecular weight of 220.30 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[(2-methylphenyl)methyl]-1,3-thiazol-4-one is sourced from PubChem (CID 2841517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).