About N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine
N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine (PubChem CID 2842110) has the molecular formula C19H18N4
and a molecular weight of 302.38 g/mol. Its IUPAC name is N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine |
| PubChem CID | 2842110 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine |
| SMILES | Cc1nc(-c2ccccc2)nc(NN=Cc2ccccc2)c1C |
| InChI | InChI=1S/C19H18N4/c1-14-15(2)21-19(17-11-7-4-8-12-17)22-18(14)23-20-13-16-9-5-3-6-10-16/h3-13H,1-2H3,(H,21,22,23) |
| InChIKey | JSKKQVVBESXVPM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine?
The IUPAC name of N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine (CID 2842110) is N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine.
What is the SMILES notation for N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine?
The canonical SMILES for N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine is Cc1nc(-c2ccccc2)nc(NN=Cc2ccccc2)c1C.
What is the InChIKey of N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine?
The InChIKey is JSKKQVVBESXVPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4/c1-14-15(2)21-19(17-11-7-4-8-12-17)22-18(14)23-20-13-16-9-5-3-6-10-16/h3-13H,1-2H3,(H,21,22,23).
What are the key properties of N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine?
N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine has a molecular weight of 302.38 g/mol, XLogP of 4.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(benzylideneamino)-5,6-dimethyl-2-phenylpyrimidin-4-amine is sourced from PubChem (CID 2842110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).