C12H21N9 — CID 2842215
4-N-butan-2-yl-6-N-propan-2-yl-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 2842215) has the molecular formula C12H21N9 and a molecular weight of 291.36 g/mol. Its IUPAC name is 4-N-butan-2-yl-6-N-propan-2-yl-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-butan-2-yl-6-N-propan-2-yl-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 2842215 |
| Molecular Formula | C12H21N9 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 4-N-butan-2-yl-6-N-propan-2-yl-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCC(C)Nc1nc(NC(C)C)nc(Nn2cnnc2)n1 |
| InChI | InChI=1S/C12H21N9/c1-5-9(4)16-11-17-10(15-8(2)3)18-12(19-11)20-21-6-13-14-7-21/h6-9H,5H2,1-4H3,(H3,15,16,17,18,19,20) |
| InChIKey | PCEIKLQJDMJQGA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |