About N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide
N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide (PubChem CID 2842499) has the molecular formula C16H26N2O2
and a molecular weight of 278.40 g/mol. Its IUPAC name is N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide.
Molecular Properties
| Compound Name | N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide |
| PubChem CID | 2842499 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide |
| SMILES | CC(=O)NC12CC3(C)CC(C)(C1)CC(NC(C)=O)(C3)C2 |
| InChI | InChI=1S/C16H26N2O2/c1-11(19)17-15-6-13(3)5-14(4,7-15)9-16(8-13,10-15)18-12(2)20/h5-10H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | MSQGNHPUFDAVHW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide?
The IUPAC name of N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide (CID 2842499) is N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide.
What is the SMILES notation for N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide?
The canonical SMILES for N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide is CC(=O)NC12CC3(C)CC(C)(C1)CC(NC(C)=O)(C3)C2.
What is the InChIKey of N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide?
The InChIKey is MSQGNHPUFDAVHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O2/c1-11(19)17-15-6-13(3)5-14(4,7-15)9-16(8-13,10-15)18-12(2)20/h5-10H2,1-4H3,(H,17,19)(H,18,20).
What are the key properties of N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide?
N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide has a molecular weight of 278.40 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide is sourced from PubChem (CID 2842499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).