C15H12N2O4 — CID 2842566
N-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)benzamide (PubChem CID 2842566) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is N-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)benzamide.
| Compound Name | N-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 2842566 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)benzamide |
| SMILES | O=C(NN1C(=O)C2C3C=CC(O3)C2C1=O)c1ccccc1 |
| InChI | InChI=1S/C15H12N2O4/c18-13(8-4-2-1-3-5-8)16-17-14(19)11-9-6-7-10(21-9)12(11)15(17)20/h1-7,9-12H,(H,16,18) |
| InChIKey | OVHZCESSRWPSTC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|