About [1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol
[1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol (PubChem CID 2842706) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is [1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol.
Molecular Properties
| Compound Name | [1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol |
| PubChem CID | 2842706 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | [1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol |
| SMILES | COc1cc(C)c(CN2CCCCC2CO)cc1C |
| InChI | InChI=1S/C16H25NO2/c1-12-9-16(19-3)13(2)8-14(12)10-17-7-5-4-6-15(17)11-18/h8-9,15,18H,4-7,10-11H2,1-3H3 |
| InChIKey | KDZAROCPKYHUQS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol?
The IUPAC name of [1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol (CID 2842706) is [1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol.
What is the SMILES notation for [1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol?
The canonical SMILES for [1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol is COc1cc(C)c(CN2CCCCC2CO)cc1C.
What is the InChIKey of [1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol?
The InChIKey is KDZAROCPKYHUQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-12-9-16(19-3)13(2)8-14(12)10-17-7-5-4-6-15(17)11-18/h8-9,15,18H,4-7,10-11H2,1-3H3.
What are the key properties of [1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol?
[1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol has a molecular weight of 263.38 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4-methoxy-2,5-dimethylphenyl)methyl]piperidin-2-yl]methanol is sourced from PubChem (CID 2842706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).