About [4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate
[4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate (PubChem CID 2843141) has the molecular formula C12H20N8O14
and a molecular weight of 500.33 g/mol. Its IUPAC name is [4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate.
Molecular Properties
| Compound Name | [4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate |
| PubChem CID | 2843141 |
| Molecular Formula | C12H20N8O14 |
| Molecular Weight | 500.33 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | [4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate |
| SMILES | O=[N+]([O-])OCCC(CN1CCN(CC(CCO[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])CC1)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C12H20N8O14/c21-15(22)11(16(23)24,1-7-33-19(29)30)9-13-3-5-14(6-4-13)10-12(17(25)26,18(27)28)2-8-34-20(31)32/h1-10H2 |
| InChIKey | WGCMNMWHQMUIGY-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 283.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.33 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate?
The IUPAC name of [4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate (CID 2843141) is [4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate.
What is the SMILES notation for [4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate?
The canonical SMILES for [4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate is O=[N+]([O-])OCCC(CN1CCN(CC(CCO[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])CC1)([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of [4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate?
The InChIKey is WGCMNMWHQMUIGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N8O14/c21-15(22)11(16(23)24,1-7-33-19(29)30)9-13-3-5-14(6-4-13)10-12(17(25)26,18(27)28)2-8-34-20(31)32/h1-10H2.
What are the key properties of [4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate?
[4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate has a molecular weight of 500.33 g/mol, XLogP of -1.70, 16 rotatable bonds, 0 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(2,2-dinitro-4-nitrooxybutyl)piperazin-1-yl]-3,3-dinitrobutyl] nitrate is sourced from PubChem (CID 2843141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).