C8H8N4O4 — CID 2843271
2-nitro-5-(prop-2-ynoxymethyl)-5,6-dihydro-[1,3]oxazolo[3,2-b][1,2,4]triazole (PubChem CID 2843271) has the molecular formula C8H8N4O4 and a molecular weight of 224.18 g/mol. Its IUPAC name is 2-nitro-5-(prop-2-ynoxymethyl)-5,6-dihydro-[1,3]oxazolo[3,2-b][1,2,4]triazole.
| Compound Name | 2-nitro-5-(prop-2-ynoxymethyl)-5,6-dihydro-[1,3]oxazolo[3,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 2843271 |
| Molecular Formula | C8H8N4O4 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-nitro-5-(prop-2-ynoxymethyl)-5,6-dihydro-[1,3]oxazolo[3,2-b][1,2,4]triazole |
| SMILES | C#CCOCC1Cn2nc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C8H8N4O4/c1-2-3-15-5-6-4-11-8(16-6)9-7(10-11)12(13)14/h1,6H,3-5H2 |
| InChIKey | ZFDKZDRIEIOREW-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|