About 1-[3-(2,6-dimethylphenoxy)propyl]imidazole
1-[3-(2,6-dimethylphenoxy)propyl]imidazole (PubChem CID 2843475) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylphenoxy)propyl]imidazole.
Molecular Properties
| Compound Name | 1-[3-(2,6-dimethylphenoxy)propyl]imidazole |
| PubChem CID | 2843475 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-[3-(2,6-dimethylphenoxy)propyl]imidazole |
| SMILES | Cc1cccc(C)c1OCCCn1ccnc1 |
| InChI | InChI=1S/C14H18N2O/c1-12-5-3-6-13(2)14(12)17-10-4-8-16-9-7-15-11-16/h3,5-7,9,11H,4,8,10H2,1-2H3 |
| InChIKey | MCCVPDUWEAWMEY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2,6-dimethylphenoxy)propyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,6-dimethylphenoxy)propyl]imidazole?
The IUPAC name of 1-[3-(2,6-dimethylphenoxy)propyl]imidazole (CID 2843475) is 1-[3-(2,6-dimethylphenoxy)propyl]imidazole.
What is the SMILES notation for 1-[3-(2,6-dimethylphenoxy)propyl]imidazole?
The canonical SMILES for 1-[3-(2,6-dimethylphenoxy)propyl]imidazole is Cc1cccc(C)c1OCCCn1ccnc1.
What is the InChIKey of 1-[3-(2,6-dimethylphenoxy)propyl]imidazole?
The InChIKey is MCCVPDUWEAWMEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O/c1-12-5-3-6-13(2)14(12)17-10-4-8-16-9-7-15-11-16/h3,5-7,9,11H,4,8,10H2,1-2H3.
What are the key properties of 1-[3-(2,6-dimethylphenoxy)propyl]imidazole?
1-[3-(2,6-dimethylphenoxy)propyl]imidazole has a molecular weight of 230.31 g/mol, XLogP of 2.97, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,6-dimethylphenoxy)propyl]imidazole is sourced from PubChem (CID 2843475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).