C14H20O4 — CID 2843614
8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene-2,3-dicarboxylic acid (PubChem CID 2843614) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene-2,3-dicarboxylic acid.
| Compound Name | 8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 2843614 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene-2,3-dicarboxylic acid |
| SMILES | CC1(C)CCCC2=C1CC(C(=O)O)C(C(=O)O)C2 |
| InChI | InChI=1S/C14H20O4/c1-14(2)5-3-4-8-6-9(12(15)16)10(13(17)18)7-11(8)14/h9-10H,3-7H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | BXGNOZXGIOGFOW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|