C14H16N2OS — CID 2843820
3-(4-propoxyphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole (PubChem CID 2843820) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 3-(4-propoxyphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 3-(4-propoxyphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 2843820 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 3-(4-propoxyphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CCCOc1ccc(C2=CSC3=NCCN23)cc1 |
| InChI | InChI=1S/C14H16N2OS/c1-2-9-17-12-5-3-11(4-6-12)13-10-18-14-15-7-8-16(13)14/h3-6,10H,2,7-9H2,1H3 |
| InChIKey | KCOISEZNGBXGMD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |