About 2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole
2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole (PubChem CID 2843837) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole |
| PubChem CID | 2843837 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole |
| SMILES | CCC1=NC(c2ccc(OC)c(OC)c2)N(O)C1(C)C |
| InChI | InChI=1S/C15H22N2O3/c1-6-13-15(2,3)17(18)14(16-13)10-7-8-11(19-4)12(9-10)20-5/h7-9,14,18H,6H2,1-5H3 |
| InChIKey | UIKHAKOFHJRPMR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole (CID 2843837) is 2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole is CCC1=NC(c2ccc(OC)c(OC)c2)N(O)C1(C)C.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole?
The InChIKey is UIKHAKOFHJRPMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-6-13-15(2,3)17(18)14(16-13)10-7-8-11(19-4)12(9-10)20-5/h7-9,14,18H,6H2,1-5H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole?
2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole has a molecular weight of 278.35 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-4-ethyl-1-hydroxy-5,5-dimethyl-2H-imidazole is sourced from PubChem (CID 2843837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).