About (4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride
(4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride (PubChem CID 2843884) has the molecular formula C10H14ClN3O3S
and a molecular weight of 291.76 g/mol. Its IUPAC name is (4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | (4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride |
| PubChem CID | 2843884 |
| Molecular Formula | C10H14ClN3O3S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | (4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)SCc1ccc(OCC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H13N3O3S.ClH/c1-2-16-9-4-3-7(6-17-10(11)12)5-8(9)13(14)15;/h3-5H,2,6H2,1H3,(H3,11,12);1H |
| InChIKey | FVVJLPABEVIZDT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride?
The IUPAC name of (4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride (CID 2843884) is (4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride.
What is the SMILES notation for (4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride?
The canonical SMILES for (4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride is Cl.[H]/N=C(\N)SCc1ccc(OCC)c([N+](=O)[O-])c1.
What is the InChIKey of (4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride?
The InChIKey is FVVJLPABEVIZDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O3S.ClH/c1-2-16-9-4-3-7(6-17-10(11)12)5-8(9)13(14)15;/h3-5H,2,6H2,1H3,(H3,11,12);1H.
What are the key properties of (4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride?
(4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride has a molecular weight of 291.76 g/mol, XLogP of 2.54, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethoxy-3-nitrophenyl)methyl carbamimidothioate;hydrochloride is sourced from PubChem (CID 2843884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).