About 2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide
2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide (PubChem CID 2843917) has the molecular formula C14H15BrN2O2
and a molecular weight of 323.19 g/mol. Its IUPAC name is 2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide.
Molecular Properties
| Compound Name | 2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide |
| PubChem CID | 2843917 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide |
| SMILES | O=C(NNC(=O)C1CC=CCC1)c1ccccc1Br |
| InChI | InChI=1S/C14H15BrN2O2/c15-12-9-5-4-8-11(12)14(19)17-16-13(18)10-6-2-1-3-7-10/h1-2,4-5,8-10H,3,6-7H2,(H,16,18)(H,17,19) |
| InChIKey | KFSMCHYHNWIZPJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide?
The IUPAC name of 2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide (CID 2843917) is 2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide.
What is the SMILES notation for 2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide?
The canonical SMILES for 2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide is O=C(NNC(=O)C1CC=CCC1)c1ccccc1Br.
What is the InChIKey of 2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide?
The InChIKey is KFSMCHYHNWIZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN2O2/c15-12-9-5-4-8-11(12)14(19)17-16-13(18)10-6-2-1-3-7-10/h1-2,4-5,8-10H,3,6-7H2,(H,16,18)(H,17,19).
What are the key properties of 2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide?
2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide has a molecular weight of 323.19 g/mol, XLogP of 2.57, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N'-(cyclohex-3-ene-1-carbonyl)benzohydrazide is sourced from PubChem (CID 2843917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).