About 5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione
5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 2844552) has the molecular formula C19H16FN3O5
and a molecular weight of 385.35 g/mol. Its IUPAC name is 5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione |
| PubChem CID | 2844552 |
| Molecular Formula | C19H16FN3O5 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | COc1ccc(/N=C/c2c(O)n(-c3ccccc3F)c(=O)[nH]c2=O)c(OC)c1 |
| InChI | InChI=1S/C19H16FN3O5/c1-27-11-7-8-14(16(9-11)28-2)21-10-12-17(24)22-19(26)23(18(12)25)15-6-4-3-5-13(15)20/h3-10,25H,1-2H3,(H,22,24,26)/b21-10+ |
| InChIKey | CFWXTKKBTFTFKQ-UFFVCSGVSA-N |
| XLogP | 2.14 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione?
The IUPAC name of 5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione (CID 2844552) is 5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione.
What is the SMILES notation for 5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione?
The canonical SMILES for 5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione is COc1ccc(/N=C/c2c(O)n(-c3ccccc3F)c(=O)[nH]c2=O)c(OC)c1.
What is the InChIKey of 5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione?
The InChIKey is CFWXTKKBTFTFKQ-UFFVCSGVSA-N. The full InChI is InChI=1S/C19H16FN3O5/c1-27-11-7-8-14(16(9-11)28-2)21-10-12-17(24)22-19(26)23(18(12)25)15-6-4-3-5-13(15)20/h3-10,25H,1-2H3,(H,22,24,26)/b21-10+.
What are the key properties of 5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione?
5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione has a molecular weight of 385.35 g/mol, XLogP of 2.14, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-dimethoxyphenyl)iminomethyl]-1-(2-fluorophenyl)-6-hydroxypyrimidine-2,4-dione is sourced from PubChem (CID 2844552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).