About (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate (PubChem CID 2844837) has the molecular formula C17H21FO2
and a molecular weight of 276.35 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate.
Molecular Properties
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate |
| PubChem CID | 2844837 |
| Molecular Formula | C17H21FO2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate |
| SMILES | CC1(C)C2CCC1(C)C(OC(=O)c1ccccc1F)C2 |
| InChI | InChI=1S/C17H21FO2/c1-16(2)11-8-9-17(16,3)14(10-11)20-15(19)12-6-4-5-7-13(12)18/h4-7,11,14H,8-10H2,1-3H3 |
| InChIKey | RYAPGRCTWCMAIU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate?
The IUPAC name of (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate (CID 2844837) is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate.
What is the SMILES notation for (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate?
The canonical SMILES for (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate is CC1(C)C2CCC1(C)C(OC(=O)c1ccccc1F)C2.
What is the InChIKey of (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate?
The InChIKey is RYAPGRCTWCMAIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21FO2/c1-16(2)11-8-9-17(16,3)14(10-11)20-15(19)12-6-4-5-7-13(12)18/h4-7,11,14H,8-10H2,1-3H3.
What are the key properties of (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate?
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate has a molecular weight of 276.35 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-fluorobenzoate is sourced from PubChem (CID 2844837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).