About 2-phenyl-5-propyl-1,2,4-triazolidine-3-thione
2-phenyl-5-propyl-1,2,4-triazolidine-3-thione (PubChem CID 2844968) has the molecular formula C11H15N3S
and a molecular weight of 221.33 g/mol. Its IUPAC name is 2-phenyl-5-propyl-1,2,4-triazolidine-3-thione.
Molecular Properties
| Compound Name | 2-phenyl-5-propyl-1,2,4-triazolidine-3-thione |
| PubChem CID | 2844968 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-phenyl-5-propyl-1,2,4-triazolidine-3-thione |
| SMILES | CCCC1NC(=S)N(c2ccccc2)N1 |
| InChI | InChI=1S/C11H15N3S/c1-2-6-10-12-11(15)14(13-10)9-7-4-3-5-8-9/h3-5,7-8,10,13H,2,6H2,1H3,(H,12,15) |
| InChIKey | DSSSGHUHYYKKGC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-5-propyl-1,2,4-triazolidine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-5-propyl-1,2,4-triazolidine-3-thione?
The IUPAC name of 2-phenyl-5-propyl-1,2,4-triazolidine-3-thione (CID 2844968) is 2-phenyl-5-propyl-1,2,4-triazolidine-3-thione.
What is the SMILES notation for 2-phenyl-5-propyl-1,2,4-triazolidine-3-thione?
The canonical SMILES for 2-phenyl-5-propyl-1,2,4-triazolidine-3-thione is CCCC1NC(=S)N(c2ccccc2)N1.
What is the InChIKey of 2-phenyl-5-propyl-1,2,4-triazolidine-3-thione?
The InChIKey is DSSSGHUHYYKKGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3S/c1-2-6-10-12-11(15)14(13-10)9-7-4-3-5-8-9/h3-5,7-8,10,13H,2,6H2,1H3,(H,12,15).
What are the key properties of 2-phenyl-5-propyl-1,2,4-triazolidine-3-thione?
2-phenyl-5-propyl-1,2,4-triazolidine-3-thione has a molecular weight of 221.33 g/mol, XLogP of 2.01, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-5-propyl-1,2,4-triazolidine-3-thione is sourced from PubChem (CID 2844968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).