About 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane
1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane (PubChem CID 2845240) has the molecular formula C15H23BrN2O2
and a molecular weight of 343.27 g/mol. Its IUPAC name is 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane |
| PubChem CID | 2845240 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane |
| SMILES | COc1cc(Br)c(CN2CCCN(C)CC2)cc1OC |
| InChI | InChI=1S/C15H23BrN2O2/c1-17-5-4-6-18(8-7-17)11-12-9-14(19-2)15(20-3)10-13(12)16/h9-10H,4-8,11H2,1-3H3 |
| InChIKey | CAPPZGDXDOBFFZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane?
The IUPAC name of 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane (CID 2845240) is 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane.
What is the SMILES notation for 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane?
The canonical SMILES for 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane is COc1cc(Br)c(CN2CCCN(C)CC2)cc1OC.
What is the InChIKey of 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane?
The InChIKey is CAPPZGDXDOBFFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23BrN2O2/c1-17-5-4-6-18(8-7-17)11-12-9-14(19-2)15(20-3)10-13(12)16/h9-10H,4-8,11H2,1-3H3.
What are the key properties of 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane?
1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane has a molecular weight of 343.27 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-methyl-1,4-diazepane is sourced from PubChem (CID 2845240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).