C14H18F2N2O2 — CID 2845349
ethyl 4-[(2,5-difluorophenyl)methyl]piperazine-1-carboxylate (PubChem CID 2845349) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is ethyl 4-[(2,5-difluorophenyl)methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(2,5-difluorophenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 2845349 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | ethyl 4-[(2,5-difluorophenyl)methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(Cc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C14H18F2N2O2/c1-2-20-14(19)18-7-5-17(6-8-18)10-11-9-12(15)3-4-13(11)16/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | OAHWRRYUPMJUML-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |