C19H32ClN3O4 — CID 2845951
N'-[(4-chlorophenyl)methyl]-N'-[3-(dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine;oxalic acid (PubChem CID 2845951) has the molecular formula C19H32ClN3O4 and a molecular weight of 401.94 g/mol. Its IUPAC name is N'-[(4-chlorophenyl)methyl]-N'-[3-(dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine;oxalic acid.
| Compound Name | N'-[(4-chlorophenyl)methyl]-N'-[3-(dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine;oxalic acid |
|---|---|
| PubChem CID | 2845951 |
| Molecular Formula | C19H32ClN3O4 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N'-[(4-chlorophenyl)methyl]-N'-[3-(dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine;oxalic acid |
| SMILES | CN(C)CCCN(CCCN(C)C)Cc1ccc(Cl)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H30ClN3.C2H2O4/c1-19(2)11-5-13-21(14-6-12-20(3)4)15-16-7-9-17(18)10-8-16;3-1(4)2(5)6/h7-10H,5-6,11-15H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | LCGBCDKQZFCDPH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|