C21H23NO2 — CID 2846955
1-(2,5-dimethylphenyl)-3-[(3,5-dimethylphenyl)methyl]pyrrolidine-2,5-dione (PubChem CID 2846955) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[(3,5-dimethylphenyl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[(3,5-dimethylphenyl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2846955 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[(3,5-dimethylphenyl)methyl]pyrrolidine-2,5-dione |
| SMILES | Cc1cc(C)cc(CC2CC(=O)N(c3cc(C)ccc3C)C2=O)c1 |
| InChI | InChI=1S/C21H23NO2/c1-13-5-6-16(4)19(10-13)22-20(23)12-18(21(22)24)11-17-8-14(2)7-15(3)9-17/h5-10,18H,11-12H2,1-4H3 |
| InChIKey | JMIBHLWQHPXEQE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|